C24H28N2O6S2 — CID 144649558
ethane;methyl 3,4-bis[(4-methylphenyl)sulfonylamino]benzoate (PubChem CID 144649558) has the molecular formula C24H28N2O6S2 and a molecular weight of 504.63 g/mol. Its IUPAC name is ethane;methyl 3,4-bis[(4-methylphenyl)sulfonylamino]benzoate.
| Compound Name | ethane;methyl 3,4-bis[(4-methylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 144649558 |
| Molecular Formula | C24H28N2O6S2 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | ethane;methyl 3,4-bis[(4-methylphenyl)sulfonylamino]benzoate |
| SMILES | CC.COC(=O)c1ccc(NS(=O)(=O)c2ccc(C)cc2)c(NS(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C22H22N2O6S2.C2H6/c1-15-4-9-18(10-5-15)31(26,27)23-20-13-8-17(22(25)30-3)14-21(20)24-32(28,29)19-11-6-16(2)7-12-19;1-2/h4-14,23-24H,1-3H3;1-2H3 |
| InChIKey | RDWQTSNTMNBORR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |