C16H17NO6S2 — CID 25469548
methyl 3-methyl-4-[(4-methylsulfonylphenyl)sulfonylamino]benzoate (PubChem CID 25469548) has the molecular formula C16H17NO6S2 and a molecular weight of 383.45 g/mol. Its IUPAC name is methyl 3-methyl-4-[(4-methylsulfonylphenyl)sulfonylamino]benzoate.
| Compound Name | methyl 3-methyl-4-[(4-methylsulfonylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 25469548 |
| Molecular Formula | C16H17NO6S2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | methyl 3-methyl-4-[(4-methylsulfonylphenyl)sulfonylamino]benzoate |
| SMILES | COC(=O)c1ccc(NS(=O)(=O)c2ccc(S(C)(=O)=O)cc2)c(C)c1 |
| InChI | InChI=1S/C16H17NO6S2/c1-11-10-12(16(18)23-2)4-9-15(11)17-25(21,22)14-7-5-13(6-8-14)24(3,19)20/h4-10,17H,1-3H3 |
| InChIKey | QIDFHQOFBISIDT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |