C23H24N2O3S — CID 143551297
methyl 5-(4-amino-3-ethylphenoxy)-2-[(4-methylphenyl)sulfanylamino]benzoate (PubChem CID 143551297) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is methyl 5-(4-amino-3-ethylphenoxy)-2-[(4-methylphenyl)sulfanylamino]benzoate.
| Compound Name | methyl 5-(4-amino-3-ethylphenoxy)-2-[(4-methylphenyl)sulfanylamino]benzoate |
|---|---|
| PubChem CID | 143551297 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | methyl 5-(4-amino-3-ethylphenoxy)-2-[(4-methylphenyl)sulfanylamino]benzoate |
| SMILES | CCc1cc(Oc2ccc(NSc3ccc(C)cc3)c(C(=O)OC)c2)ccc1N |
| InChI | InChI=1S/C23H24N2O3S/c1-4-16-13-17(7-11-21(16)24)28-18-8-12-22(20(14-18)23(26)27-3)25-29-19-9-5-15(2)6-10-19/h5-14,25H,4,24H2,1-3H3 |
| InChIKey | DPVNMQAOTONODM-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|