C28H24N2O6S2 — CID 143551269
5-[3-carboxy-4-[(4-methylphenyl)sulfinylamino]phenoxy]-2-[(4-methylphenyl)sulfanylamino]benzoic acid (PubChem CID 143551269) has the molecular formula C28H24N2O6S2 and a molecular weight of 548.64 g/mol. Its IUPAC name is 5-[3-carboxy-4-[(4-methylphenyl)sulfinylamino]phenoxy]-2-[(4-methylphenyl)sulfanylamino]benzoic acid.
| Compound Name | 5-[3-carboxy-4-[(4-methylphenyl)sulfinylamino]phenoxy]-2-[(4-methylphenyl)sulfanylamino]benzoic acid |
|---|---|
| PubChem CID | 143551269 |
| Molecular Formula | C28H24N2O6S2 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | 5-[3-carboxy-4-[(4-methylphenyl)sulfinylamino]phenoxy]-2-[(4-methylphenyl)sulfanylamino]benzoic acid |
| SMILES | Cc1ccc(SNc2ccc(Oc3ccc(NS(=O)c4ccc(C)cc4)c(C(=O)O)c3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C28H24N2O6S2/c1-17-3-9-21(10-4-17)37-29-25-13-7-19(15-23(25)27(31)32)36-20-8-14-26(24(16-20)28(33)34)30-38(35)22-11-5-18(2)6-12-22/h3-16,29-30H,1-2H3,(H,31,32)(H,33,34) |
| InChIKey | HYOTUSREWQGEQQ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|