C23H23N3O6S — CID 89011777
methyl 5-[3-(ethylamino)-4-nitrosophenoxy]-2-[(4-methylphenyl)sulfonylamino]benzoate (PubChem CID 89011777) has the molecular formula C23H23N3O6S and a molecular weight of 469.52 g/mol. Its IUPAC name is methyl 5-[3-(ethylamino)-4-nitrosophenoxy]-2-[(4-methylphenyl)sulfonylamino]benzoate.
| Compound Name | methyl 5-[3-(ethylamino)-4-nitrosophenoxy]-2-[(4-methylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 89011777 |
| Molecular Formula | C23H23N3O6S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | methyl 5-[3-(ethylamino)-4-nitrosophenoxy]-2-[(4-methylphenyl)sulfonylamino]benzoate |
| SMILES | CCNc1cc(Oc2ccc(NS(=O)(=O)c3ccc(C)cc3)c(C(=O)OC)c2)ccc1N=O |
| InChI | InChI=1S/C23H23N3O6S/c1-4-24-22-14-17(8-12-21(22)25-28)32-16-7-11-20(19(13-16)23(27)31-3)26-33(29,30)18-9-5-15(2)6-10-18/h5-14,24,26H,4H2,1-3H3 |
| InChIKey | MJLGRZMPTCDWMW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |