C27H22N2O6S — CID 89011824
methyl 2-[(4-methylphenyl)sulfonylamino]-5-(4-nitroso-3-phenylphenoxy)benzoate (PubChem CID 89011824) has the molecular formula C27H22N2O6S and a molecular weight of 502.55 g/mol. Its IUPAC name is methyl 2-[(4-methylphenyl)sulfonylamino]-5-(4-nitroso-3-phenylphenoxy)benzoate.
| Compound Name | methyl 2-[(4-methylphenyl)sulfonylamino]-5-(4-nitroso-3-phenylphenoxy)benzoate |
|---|---|
| PubChem CID | 89011824 |
| Molecular Formula | C27H22N2O6S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | methyl 2-[(4-methylphenyl)sulfonylamino]-5-(4-nitroso-3-phenylphenoxy)benzoate |
| SMILES | COC(=O)c1cc(Oc2ccc(N=O)c(-c3ccccc3)c2)ccc1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H22N2O6S/c1-18-8-12-22(13-9-18)36(32,33)29-26-15-11-21(17-24(26)27(30)34-2)35-20-10-14-25(28-31)23(16-20)19-6-4-3-5-7-19/h3-17,29H,1-2H3 |
| InChIKey | FDDFHRQKDINDDX-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |