C22H16F3N2O7S- — CID 68672151
2-methoxycarbonyl-1-(4-methyl-N-sulfinatoanilino)-4-[4-nitro-3-(trifluoromethyl)phenoxy]benzene (PubChem CID 68672151) has the molecular formula C22H16F3N2O7S- and a molecular weight of 509.44 g/mol. Its IUPAC name is 2-methoxycarbonyl-1-(4-methyl-N-sulfinatoanilino)-4-[4-nitro-3-(trifluoromethyl)phenoxy]benzene.
| Compound Name | 2-methoxycarbonyl-1-(4-methyl-N-sulfinatoanilino)-4-[4-nitro-3-(trifluoromethyl)phenoxy]benzene |
|---|---|
| PubChem CID | 68672151 |
| Molecular Formula | C22H16F3N2O7S- |
| Molecular Weight | 509.44 g/mol |
| Exact Mass | 509.06 |
| IUPAC Name | 2-methoxycarbonyl-1-(4-methyl-N-sulfinatoanilino)-4-[4-nitro-3-(trifluoromethyl)phenoxy]benzene |
| SMILES | COC(=O)c1cc(Oc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)ccc1N(c1ccc(C)cc1)S(=O)[O-] |
| InChI | InChI=1S/C22H17F3N2O7S/c1-13-3-5-14(6-4-13)26(35(31)32)19-9-7-15(11-17(19)21(28)33-2)34-16-8-10-20(27(29)30)18(12-16)22(23,24)25/h3-12H,1-2H3,(H,31,32)/p-1 |
| InChIKey | CIMUVOOWQHCOHY-UHFFFAOYSA-M |
| XLogP | 5.43 |
| TPSA | 122.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|