C23H21N2O8S- — CID 68671539
4-(3-ethoxy-4-nitrophenoxy)-2-methoxycarbonyl-1-(4-methyl-N-sulfinatoanilino)benzene (PubChem CID 68671539) has the molecular formula C23H21N2O8S- and a molecular weight of 485.49 g/mol. Its IUPAC name is 4-(3-ethoxy-4-nitrophenoxy)-2-methoxycarbonyl-1-(4-methyl-N-sulfinatoanilino)benzene.
| Compound Name | 4-(3-ethoxy-4-nitrophenoxy)-2-methoxycarbonyl-1-(4-methyl-N-sulfinatoanilino)benzene |
|---|---|
| PubChem CID | 68671539 |
| Molecular Formula | C23H21N2O8S- |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 4-(3-ethoxy-4-nitrophenoxy)-2-methoxycarbonyl-1-(4-methyl-N-sulfinatoanilino)benzene |
| SMILES | CCOc1cc(Oc2ccc(N(c3ccc(C)cc3)S(=O)[O-])c(C(=O)OC)c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H22N2O8S/c1-4-32-22-14-18(10-12-21(22)25(27)28)33-17-9-11-20(19(13-17)23(26)31-3)24(34(29)30)16-7-5-15(2)6-8-16/h5-14H,4H2,1-3H3,(H,29,30)/p-1 |
| InChIKey | TUMJSHZZBATLKM-UHFFFAOYSA-M |
| XLogP | 4.81 |
| TPSA | 131.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|