C29H28N2O8S2 — CID 68672161
5-[3-ethoxy-4-(4-methyl-N-sulfinoanilino)phenoxy]-2-(4-methyl-N-sulfinoanilino)benzoic acid (PubChem CID 68672161) has the molecular formula C29H28N2O8S2 and a molecular weight of 596.68 g/mol. Its IUPAC name is 5-[3-ethoxy-4-(4-methyl-N-sulfinoanilino)phenoxy]-2-(4-methyl-N-sulfinoanilino)benzoic acid.
| Compound Name | 5-[3-ethoxy-4-(4-methyl-N-sulfinoanilino)phenoxy]-2-(4-methyl-N-sulfinoanilino)benzoic acid |
|---|---|
| PubChem CID | 68672161 |
| Molecular Formula | C29H28N2O8S2 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.13 |
| IUPAC Name | 5-[3-ethoxy-4-(4-methyl-N-sulfinoanilino)phenoxy]-2-(4-methyl-N-sulfinoanilino)benzoic acid |
| SMILES | CCOc1cc(Oc2ccc(N(c3ccc(C)cc3)S(=O)O)c(C(=O)O)c2)ccc1N(c1ccc(C)cc1)S(=O)O |
| InChI | InChI=1S/C29H28N2O8S2/c1-4-38-28-18-24(14-16-27(28)31(41(36)37)22-11-7-20(3)8-12-22)39-23-13-15-26(25(17-23)29(32)33)30(40(34)35)21-9-5-19(2)6-10-21/h5-18H,4H2,1-3H3,(H,32,33)(H,34,35)(H,36,37) |
| InChIKey | TXHIYTJYRDCXEB-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 136.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|