C30H28N2O7S — CID 91559563
4-[4-[(N-acetyl-2-hydroxyanilino)methyl]phenoxy]-2-methoxycarbonyl-1-(4-methyl-N-sulfinoanilino)benzene (PubChem CID 91559563) has the molecular formula C30H28N2O7S and a molecular weight of 560.63 g/mol. Its IUPAC name is 4-[4-[(N-acetyl-2-hydroxyanilino)methyl]phenoxy]-2-methoxycarbonyl-1-(4-methyl-N-sulfinoanilino)benzene.
| Compound Name | 4-[4-[(N-acetyl-2-hydroxyanilino)methyl]phenoxy]-2-methoxycarbonyl-1-(4-methyl-N-sulfinoanilino)benzene |
|---|---|
| PubChem CID | 91559563 |
| Molecular Formula | C30H28N2O7S |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | 4-[4-[(N-acetyl-2-hydroxyanilino)methyl]phenoxy]-2-methoxycarbonyl-1-(4-methyl-N-sulfinoanilino)benzene |
| SMILES | COC(=O)c1cc(Oc2ccc(CN(C(C)=O)c3ccccc3O)cc2)ccc1N(c1ccc(C)cc1)S(=O)O |
| InChI | InChI=1S/C30H28N2O7S/c1-20-8-12-23(13-9-20)32(40(36)37)27-17-16-25(18-26(27)30(35)38-3)39-24-14-10-22(11-15-24)19-31(21(2)33)28-6-4-5-7-29(28)34/h4-18,34H,19H2,1-3H3,(H,36,37) |
| InChIKey | JBMFAQDNOOCOLM-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|