C34H40N2O4S2 — CID 118986815
N-[4-[4-[benzenesulfonyl(pentyl)amino]phenyl]phenyl]-N-pentylbenzenesulfonamide (PubChem CID 118986815) has the molecular formula C34H40N2O4S2 and a molecular weight of 604.84 g/mol. Its IUPAC name is N-[4-[4-[benzenesulfonyl(pentyl)amino]phenyl]phenyl]-N-pentylbenzenesulfonamide.
| Compound Name | N-[4-[4-[benzenesulfonyl(pentyl)amino]phenyl]phenyl]-N-pentylbenzenesulfonamide |
|---|---|
| PubChem CID | 118986815 |
| Molecular Formula | C34H40N2O4S2 |
| Molecular Weight | 604.84 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | N-[4-[4-[benzenesulfonyl(pentyl)amino]phenyl]phenyl]-N-pentylbenzenesulfonamide |
| SMILES | CCCCCN(c1ccc(-c2ccc(N(CCCCC)S(=O)(=O)c3ccccc3)cc2)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C34H40N2O4S2/c1-3-5-13-27-35(41(37,38)33-15-9-7-10-16-33)31-23-19-29(20-24-31)30-21-25-32(26-22-30)36(28-14-6-4-2)42(39,40)34-17-11-8-12-18-34/h7-12,15-26H,3-6,13-14,27-28H2,1-2H3 |
| InChIKey | HDKOVLIJGKDYHF-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.84 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|