C17H25NO4S — CID 15548420
tert-butyl N-(3-methylbut-3-enyl)-N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 15548420) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is tert-butyl N-(3-methylbut-3-enyl)-N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | tert-butyl N-(3-methylbut-3-enyl)-N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 15548420 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | tert-butyl N-(3-methylbut-3-enyl)-N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | C=C(C)CCN(C(=O)OC(C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H25NO4S/c1-13(2)11-12-18(16(19)22-17(4,5)6)23(20,21)15-9-7-14(3)8-10-15/h7-10H,1,11-12H2,2-6H3 |
| InChIKey | SHCYVHDGMKSNML-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|