C20H26N2O6S2 — CID 160689143
tert-butyl N-[methyl-(4-methylphenyl)sulfonylamino]-N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 160689143) has the molecular formula C20H26N2O6S2 and a molecular weight of 454.57 g/mol. Its IUPAC name is tert-butyl N-[methyl-(4-methylphenyl)sulfonylamino]-N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | tert-butyl N-[methyl-(4-methylphenyl)sulfonylamino]-N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 160689143 |
| Molecular Formula | C20H26N2O6S2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | tert-butyl N-[methyl-(4-methylphenyl)sulfonylamino]-N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | Cc1ccc(S(=O)(=O)N(C)N(C(=O)OC(C)(C)C)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H26N2O6S2/c1-15-7-11-17(12-8-15)29(24,25)21(6)22(19(23)28-20(3,4)5)30(26,27)18-13-9-16(2)10-14-18/h7-14H,1-6H3 |
| InChIKey | DTISKFBGOMZOMN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|