C19H23NO5S — CID 11188083
tert-butyl N-(4-methylphenyl)sulfonyl-N-(7-oxospiro[2.4]hept-5-en-6-yl)carbamate (PubChem CID 11188083) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is tert-butyl N-(4-methylphenyl)sulfonyl-N-(7-oxospiro[2.4]hept-5-en-6-yl)carbamate.
| Compound Name | tert-butyl N-(4-methylphenyl)sulfonyl-N-(7-oxospiro[2.4]hept-5-en-6-yl)carbamate |
|---|---|
| PubChem CID | 11188083 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | tert-butyl N-(4-methylphenyl)sulfonyl-N-(7-oxospiro[2.4]hept-5-en-6-yl)carbamate |
| SMILES | Cc1ccc(S(=O)(=O)N(C(=O)OC(C)(C)C)C2=CCC3(CC3)C2=O)cc1 |
| InChI | InChI=1S/C19H23NO5S/c1-13-5-7-14(8-6-13)26(23,24)20(17(22)25-18(2,3)4)15-9-10-19(11-12-19)16(15)21/h5-9H,10-12H2,1-4H3 |
| InChIKey | MYDVNBSQTQTQID-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |