C17H25NO4S2 — CID 90306719
tert-butyl N-methyl-N-[1-[(4-methylphenyl)sulfonylsulfanylmethyl]cyclopropyl]carbamate (PubChem CID 90306719) has the molecular formula C17H25NO4S2 and a molecular weight of 371.52 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[1-[(4-methylphenyl)sulfonylsulfanylmethyl]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[1-[(4-methylphenyl)sulfonylsulfanylmethyl]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 90306719 |
| Molecular Formula | C17H25NO4S2 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | tert-butyl N-methyl-N-[1-[(4-methylphenyl)sulfonylsulfanylmethyl]cyclopropyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)SCC2(N(C)C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C17H25NO4S2/c1-13-6-8-14(9-7-13)24(20,21)23-12-17(10-11-17)18(5)15(19)22-16(2,3)4/h6-9H,10-12H2,1-5H3 |
| InChIKey | YQXOFSSGZRALJF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|