C19H26O4S2 — CID 10915941
[(1S,2R,4R)-7,7-dimethyl-1-[(4-methylphenyl)sulfonylsulfanylmethyl]-2-bicyclo[2.2.1]heptanyl] acetate (PubChem CID 10915941) has the molecular formula C19H26O4S2 and a molecular weight of 382.55 g/mol. Its IUPAC name is [(1S,2R,4R)-7,7-dimethyl-1-[(4-methylphenyl)sulfonylsulfanylmethyl]-2-bicyclo[2.2.1]heptanyl] acetate.
| Compound Name | [(1S,2R,4R)-7,7-dimethyl-1-[(4-methylphenyl)sulfonylsulfanylmethyl]-2-bicyclo[2.2.1]heptanyl] acetate |
|---|---|
| PubChem CID | 10915941 |
| Molecular Formula | C19H26O4S2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | [(1S,2R,4R)-7,7-dimethyl-1-[(4-methylphenyl)sulfonylsulfanylmethyl]-2-bicyclo[2.2.1]heptanyl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H]2CC[C@]1(CSS(=O)(=O)c1ccc(C)cc1)C2(C)C |
| InChI | InChI=1S/C19H26O4S2/c1-13-5-7-16(8-6-13)25(21,22)24-12-19-10-9-15(18(19,3)4)11-17(19)23-14(2)20/h5-8,15,17H,9-12H2,1-4H3/t15-,17-,19-/m1/s1 |
| InChIKey | PRSSJCYCPCNTDD-SZVBFZGTSA-N |
| XLogP | 4.17 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|