C29H42O6S — CID 101106941
[(3S,5S,8R,9S,10S,13S,14S,16R,17S)-17-hydroxy-10,13-dimethyl-16-[(4-methylphenyl)sulfonyloxymethyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 101106941) has the molecular formula C29H42O6S and a molecular weight of 518.72 g/mol. Its IUPAC name is [(3S,5S,8R,9S,10S,13S,14S,16R,17S)-17-hydroxy-10,13-dimethyl-16-[(4-methylphenyl)sulfonyloxymethyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5S,8R,9S,10S,13S,14S,16R,17S)-17-hydroxy-10,13-dimethyl-16-[(4-methylphenyl)sulfonyloxymethyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 101106941 |
| Molecular Formula | C29H42O6S |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | [(3S,5S,8R,9S,10S,13S,14S,16R,17S)-17-hydroxy-10,13-dimethyl-16-[(4-methylphenyl)sulfonyloxymethyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](O)[C@@H](COS(=O)(=O)c4ccc(C)cc4)C[C@@H]32)C1 |
| InChI | InChI=1S/C29H42O6S/c1-18-5-8-23(9-6-18)36(32,33)34-17-20-15-26-24-10-7-21-16-22(35-19(2)30)11-13-28(21,3)25(24)12-14-29(26,4)27(20)31/h5-6,8-9,20-22,24-27,31H,7,10-17H2,1-4H3/t20-,21+,22+,24-,25+,26+,27+,28+,29+/m1/s1 |
| InChIKey | TVFQZOAEFDTHSB-XDBCMLDNSA-N |
| XLogP | 5.26 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|