C26H38O4S — CID 125030079
[(5R,8R,9R,10S,13S,14R,16R,17R)-17-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl] 4-methylbenzenesulfonate (PubChem CID 125030079) has the molecular formula C26H38O4S and a molecular weight of 446.65 g/mol. Its IUPAC name is [(5R,8R,9R,10S,13S,14R,16R,17R)-17-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl] 4-methylbenzenesulfonate.
| Compound Name | [(5R,8R,9R,10S,13S,14R,16R,17R)-17-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 125030079 |
| Molecular Formula | C26H38O4S |
| Molecular Weight | 446.65 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | [(5R,8R,9R,10S,13S,14R,16R,17R)-17-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2C[C@@H]3[C@@H]4CC[C@H]5CCCC[C@]5(C)[C@@H]4CC[C@]3(C)[C@H]2O)cc1 |
| InChI | InChI=1S/C26H38O4S/c1-17-7-10-19(11-8-17)31(28,29)30-23-16-22-20-12-9-18-6-4-5-14-25(18,2)21(20)13-15-26(22,3)24(23)27/h7-8,10-11,18,20-24,27H,4-6,9,12-16H2,1-3H3/t18-,20-,21-,22-,23-,24+,25+,26+/m1/s1 |
| InChIKey | BKOGUJNRCSWUNA-ZWXODBCLSA-N |
| XLogP | 5.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.65 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|