C31H48O3S — CID 91580953
[(4R)-4-[(10S,13R,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl] 4-methylbenzenesulfonate (PubChem CID 91580953) has the molecular formula C31H48O3S and a molecular weight of 500.79 g/mol. Its IUPAC name is [(4R)-4-[(10S,13R,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl] 4-methylbenzenesulfonate.
| Compound Name | [(4R)-4-[(10S,13R,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 91580953 |
| Molecular Formula | C31H48O3S |
| Molecular Weight | 500.79 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | [(4R)-4-[(10S,13R,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC[C@@H](C)[C@H]2CCC3C4CCC5CCCC[C@]5(C)C4CC[C@@]32C)cc1 |
| InChI | InChI=1S/C31H48O3S/c1-22-10-13-25(14-11-22)35(32,33)34-21-7-8-23(2)27-16-17-28-26-15-12-24-9-5-6-19-30(24,3)29(26)18-20-31(27,28)4/h10-11,13-14,23-24,26-29H,5-9,12,15-21H2,1-4H3/t23-,24?,26?,27-,28?,29?,30+,31-/m1/s1 |
| InChIKey | IRQUKJRWIAZSEU-OJVIJZTGSA-N |
| XLogP | 8.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.79 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|