C26H46O4S — CID 144786840
2-[4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentoxy]ethanesulfonic acid (PubChem CID 144786840) has the molecular formula C26H46O4S and a molecular weight of 454.72 g/mol. Its IUPAC name is 2-[4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentoxy]ethanesulfonic acid.
| Compound Name | 2-[4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 144786840 |
| Molecular Formula | C26H46O4S |
| Molecular Weight | 454.72 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | 2-[4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentoxy]ethanesulfonic acid |
| SMILES | CC(CCCOCCS(=O)(=O)O)C1CCC2C3CCC4CCCCC4(C)C3CCC12C |
| InChI | InChI=1S/C26H46O4S/c1-19(7-6-16-30-17-18-31(27,28)29)22-11-12-23-21-10-9-20-8-4-5-14-25(20,2)24(21)13-15-26(22,23)3/h19-24H,4-18H2,1-3H3,(H,27,28,29) |
| InChIKey | TZMGYQXJPZXAJV-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.72 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|