C26H44NNaO4S — CID 132917378
sodium (4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-(2-sulfoethyl)pentanimidate (PubChem CID 132917378) has the molecular formula C26H44NNaO4S and a molecular weight of 489.70 g/mol. Its IUPAC name is sodium (4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-(2-sulfoethyl)pentanimidate.
| Compound Name | sodium (4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-(2-sulfoethyl)pentanimidate |
|---|---|
| PubChem CID | 132917378 |
| Molecular Formula | C26H44NNaO4S |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | sodium (4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-(2-sulfoethyl)pentanimidate |
| SMILES | C[C@H](CC/C([O-])=N/CCS(=O)(=O)O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4CCCC[C@]4(C)[C@H]3CC[C@]12C.[Na+] |
| InChI | InChI=1S/C26H45NO4S.Na/c1-18(7-12-24(28)27-16-17-32(29,30)31)21-10-11-22-20-9-8-19-6-4-5-14-25(19,2)23(20)13-15-26(21,22)3;/h18-23H,4-17H2,1-3H3,(H,27,28)(H,29,30,31);/q;+1/p-1/t18-,19+,20+,21-,22+,23+,25+,26-;/m1./s1 |
| InChIKey | WDKPEMUXGJVEFA-ORKUVLCLSA-M |
| XLogP | 2.10 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|