C26H38O3S — CID 45043739
[(5R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-methylbenzenesulfonate (PubChem CID 45043739) has the molecular formula C26H38O3S and a molecular weight of 430.65 g/mol. Its IUPAC name is [(5R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-methylbenzenesulfonate.
| Compound Name | [(5R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 45043739 |
| Molecular Formula | C26H38O3S |
| Molecular Weight | 430.65 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | [(5R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCC3C4CC[C@H]5CCCCC5(C)C4CCC23C)cc1 |
| InChI | InChI=1S/C26H38O3S/c1-18-7-10-20(11-8-18)30(27,28)29-24-14-13-22-21-12-9-19-6-4-5-16-25(19,2)23(21)15-17-26(22,24)3/h7-8,10-11,19,21-24H,4-6,9,12-17H2,1-3H3/t19-,21?,22?,23?,24?,25?,26?/m1/s1 |
| InChIKey | KNJVWAVLNHNHKV-XNRNVMTBSA-N |
| XLogP | 6.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.65 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|