C28H40O5S — CID 125031439
[(5S,8R,9S,10S,13S,14R,17R)-10,13-dimethylspiro[1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-2,2'-1,3-dioxolane]-17-yl] 4-methylbenzenesulfonate (PubChem CID 125031439) has the molecular formula C28H40O5S and a molecular weight of 488.69 g/mol. Its IUPAC name is [(5S,8R,9S,10S,13S,14R,17R)-10,13-dimethylspiro[1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-2,2'-1,3-dioxolane]-17-yl] 4-methylbenzenesulfonate.
| Compound Name | [(5S,8R,9S,10S,13S,14R,17R)-10,13-dimethylspiro[1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-2,2'-1,3-dioxolane]-17-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 125031439 |
| Molecular Formula | C28H40O5S |
| Molecular Weight | 488.69 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | [(5S,8R,9S,10S,13S,14R,17R)-10,13-dimethylspiro[1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-2,2'-1,3-dioxolane]-17-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2CC[C@@H]3[C@@H]4CC[C@H]5CCC6(C[C@]5(C)[C@H]4CC[C@@]32C)OCCO6)cc1 |
| InChI | InChI=1S/C28H40O5S/c1-19-4-7-21(8-5-19)34(29,30)33-25-11-10-23-22-9-6-20-12-15-28(31-16-17-32-28)18-27(20,3)24(22)13-14-26(23,25)2/h4-5,7-8,20,22-25H,6,9-18H2,1-3H3/t20-,22-,23+,24-,25+,26-,27-/m0/s1 |
| InChIKey | OJMNATGGORNTTE-MUMZUMCZSA-N |
| XLogP | 5.85 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.69 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|