C23H34O8S — CID 161145350
1,4-dioxaspiro[4.5]decan-8-ol;1,4-dioxaspiro[4.5]decan-8-yl 4-methylbenzenesulfonate (PubChem CID 161145350) has the molecular formula C23H34O8S and a molecular weight of 470.58 g/mol. Its IUPAC name is 1,4-dioxaspiro[4.5]decan-8-ol;1,4-dioxaspiro[4.5]decan-8-yl 4-methylbenzenesulfonate.
| Compound Name | 1,4-dioxaspiro[4.5]decan-8-ol;1,4-dioxaspiro[4.5]decan-8-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 161145350 |
| Molecular Formula | C23H34O8S |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 1,4-dioxaspiro[4.5]decan-8-ol;1,4-dioxaspiro[4.5]decan-8-yl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCC3(CC2)OCCO3)cc1.OC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C15H20O5S.C8H14O3/c1-12-2-4-14(5-3-12)21(16,17)20-13-6-8-15(9-7-13)18-10-11-19-15;9-7-1-3-8(4-2-7)10-5-6-11-8/h2-5,13H,6-11H2,1H3;7,9H,1-6H2 |
| InChIKey | UNZAOEJJFUFOOK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|