C23H34O4S — CID 165035679
spiro[2.5]octan-6-ol;spiro[2.5]octan-6-yl 4-methylbenzenesulfonate (PubChem CID 165035679) has the molecular formula C23H34O4S and a molecular weight of 406.59 g/mol. Its IUPAC name is spiro[2.5]octan-6-ol;spiro[2.5]octan-6-yl 4-methylbenzenesulfonate.
| Compound Name | spiro[2.5]octan-6-ol;spiro[2.5]octan-6-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 165035679 |
| Molecular Formula | C23H34O4S |
| Molecular Weight | 406.59 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | spiro[2.5]octan-6-ol;spiro[2.5]octan-6-yl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCC3(CC2)CC3)cc1.OC1CCC2(CC1)CC2 |
| InChI | InChI=1S/C15H20O3S.C8H14O/c1-12-2-4-14(5-3-12)19(16,17)18-13-6-8-15(9-7-13)10-11-15;9-7-1-3-8(4-2-7)5-6-8/h2-5,13H,6-11H2,1H3;7,9H,1-6H2 |
| InChIKey | NINDDDBSDJQTGG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.59 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|