C22H28O5S2 — CID 67174130
4,4-bis[(4-methylphenyl)sulfonylmethyl]cyclohexan-1-ol (PubChem CID 67174130) has the molecular formula C22H28O5S2 and a molecular weight of 436.60 g/mol. Its IUPAC name is 4,4-bis[(4-methylphenyl)sulfonylmethyl]cyclohexan-1-ol.
| Compound Name | 4,4-bis[(4-methylphenyl)sulfonylmethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 67174130 |
| Molecular Formula | C22H28O5S2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 4,4-bis[(4-methylphenyl)sulfonylmethyl]cyclohexan-1-ol |
| SMILES | Cc1ccc(S(=O)(=O)CC2(CS(=O)(=O)c3ccc(C)cc3)CCC(O)CC2)cc1 |
| InChI | InChI=1S/C22H28O5S2/c1-17-3-7-20(8-4-17)28(24,25)15-22(13-11-19(23)12-14-22)16-29(26,27)21-9-5-18(2)6-10-21/h3-10,19,23H,11-16H2,1-2H3 |
| InChIKey | DOLCRLLCNMJMNS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |