C12H19NO3S — CID 123159531
1-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]piperidin-4-ol (PubChem CID 123159531) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is 1-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]piperidin-4-ol.
| Compound Name | 1-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]piperidin-4-ol |
|---|---|
| PubChem CID | 123159531 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 1-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]piperidin-4-ol |
| SMILES | Cc1ccc(S(O)(O)N2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C12H19NO3S/c1-10-2-4-12(5-3-10)17(15,16)13-8-6-11(14)7-9-13/h2-5,11,14-16H,6-9H2,1H3 |
| InChIKey | DPEXWHOPIOYBEZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |