C15H22ClNO3S — CID 102179755
(3S,4R)-3-(2-chloropropan-2-yl)-1-(4-methylphenyl)sulfonylpiperidin-4-ol (PubChem CID 102179755) has the molecular formula C15H22ClNO3S and a molecular weight of 331.87 g/mol. Its IUPAC name is (3S,4R)-3-(2-chloropropan-2-yl)-1-(4-methylphenyl)sulfonylpiperidin-4-ol.
| Compound Name | (3S,4R)-3-(2-chloropropan-2-yl)-1-(4-methylphenyl)sulfonylpiperidin-4-ol |
|---|---|
| PubChem CID | 102179755 |
| Molecular Formula | C15H22ClNO3S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | (3S,4R)-3-(2-chloropropan-2-yl)-1-(4-methylphenyl)sulfonylpiperidin-4-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@@H](O)[C@@H](C(C)(C)Cl)C2)cc1 |
| InChI | InChI=1S/C15H22ClNO3S/c1-11-4-6-12(7-5-11)21(19,20)17-9-8-14(18)13(10-17)15(2,3)16/h4-7,13-14,18H,8-10H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | SKIQKVMHKGRHRG-UONOGXRCSA-N |
| XLogP | 2.38 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|