C20H23NO3S — CID 177395494
(3R,4R)-1-(4-methylphenyl)sulfonyl-3-(1-phenylethenyl)piperidin-4-ol (PubChem CID 177395494) has the molecular formula C20H23NO3S and a molecular weight of 357.48 g/mol. Its IUPAC name is (3R,4R)-1-(4-methylphenyl)sulfonyl-3-(1-phenylethenyl)piperidin-4-ol.
| Compound Name | (3R,4R)-1-(4-methylphenyl)sulfonyl-3-(1-phenylethenyl)piperidin-4-ol |
|---|---|
| PubChem CID | 177395494 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (3R,4R)-1-(4-methylphenyl)sulfonyl-3-(1-phenylethenyl)piperidin-4-ol |
| SMILES | C=C(c1ccccc1)[C@@H]1CN(S(=O)(=O)c2ccc(C)cc2)CC[C@H]1O |
| InChI | InChI=1S/C20H23NO3S/c1-15-8-10-18(11-9-15)25(23,24)21-13-12-20(22)19(14-21)16(2)17-6-4-3-5-7-17/h3-11,19-20,22H,2,12-14H2,1H3/t19-,20+/m0/s1 |
| InChIKey | TXPYQTZHUIUNRH-VQTJNVASSA-N |
| XLogP | 3.08 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |