C20H23NO2S — CID 100958577
(2R,5S)-2-methyl-1-(4-methylphenyl)sulfonyl-5-(1-phenylethenyl)pyrrolidine (PubChem CID 100958577) has the molecular formula C20H23NO2S and a molecular weight of 341.48 g/mol. Its IUPAC name is (2R,5S)-2-methyl-1-(4-methylphenyl)sulfonyl-5-(1-phenylethenyl)pyrrolidine.
| Compound Name | (2R,5S)-2-methyl-1-(4-methylphenyl)sulfonyl-5-(1-phenylethenyl)pyrrolidine |
|---|---|
| PubChem CID | 100958577 |
| Molecular Formula | C20H23NO2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (2R,5S)-2-methyl-1-(4-methylphenyl)sulfonyl-5-(1-phenylethenyl)pyrrolidine |
| SMILES | C=C(c1ccccc1)[C@@H]1CC[C@@H](C)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H23NO2S/c1-15-9-12-19(13-10-15)24(22,23)21-16(2)11-14-20(21)17(3)18-7-5-4-6-8-18/h4-10,12-13,16,20H,3,11,14H2,1-2H3/t16-,20+/m1/s1 |
| InChIKey | HOHFCLLJCDVHBA-UZLBHIALSA-N |
| XLogP | 4.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |