C25H25NO2S — CID 15422060
(2S,4S)-2-benzyl-1-(4-methylphenyl)sulfonyl-4-(1-phenylethenyl)azetidine (PubChem CID 15422060) has the molecular formula C25H25NO2S and a molecular weight of 403.55 g/mol. Its IUPAC name is (2S,4S)-2-benzyl-1-(4-methylphenyl)sulfonyl-4-(1-phenylethenyl)azetidine.
| Compound Name | (2S,4S)-2-benzyl-1-(4-methylphenyl)sulfonyl-4-(1-phenylethenyl)azetidine |
|---|---|
| PubChem CID | 15422060 |
| Molecular Formula | C25H25NO2S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | (2S,4S)-2-benzyl-1-(4-methylphenyl)sulfonyl-4-(1-phenylethenyl)azetidine |
| SMILES | C=C(c1ccccc1)[C@@H]1C[C@H](Cc2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H25NO2S/c1-19-13-15-24(16-14-19)29(27,28)26-23(17-21-9-5-3-6-10-21)18-25(26)20(2)22-11-7-4-8-12-22/h3-16,23,25H,2,17-18H2,1H3/t23-,25-/m0/s1 |
| InChIKey | HFBODVLXMNSBBA-ZCYQVOJMSA-N |
| XLogP | 5.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |