C23H28O8S2 — CID 175505300
ethyl 1,4-bis-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate (PubChem CID 175505300) has the molecular formula C23H28O8S2 and a molecular weight of 496.60 g/mol. Its IUPAC name is ethyl 1,4-bis-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate.
| Compound Name | ethyl 1,4-bis-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 175505300 |
| Molecular Formula | C23H28O8S2 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | ethyl 1,4-bis-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(OS(=O)(=O)c2ccc(C)cc2)CCC(OS(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C23H28O8S2/c1-4-29-22(24)23(31-33(27,28)21-11-7-18(3)8-12-21)15-13-19(14-16-23)30-32(25,26)20-9-5-17(2)6-10-20/h5-12,19H,4,13-16H2,1-3H3 |
| InChIKey | PRMZJYFLTFWTOO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|