C18H24O7S — CID 139713306
diethyl 3-[(4-methylphenyl)sulfonyloxymethyl]cyclobutane-1,1-dicarboxylate (PubChem CID 139713306) has the molecular formula C18H24O7S and a molecular weight of 384.45 g/mol. Its IUPAC name is diethyl 3-[(4-methylphenyl)sulfonyloxymethyl]cyclobutane-1,1-dicarboxylate.
| Compound Name | diethyl 3-[(4-methylphenyl)sulfonyloxymethyl]cyclobutane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 139713306 |
| Molecular Formula | C18H24O7S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | diethyl 3-[(4-methylphenyl)sulfonyloxymethyl]cyclobutane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(COS(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C18H24O7S/c1-4-23-16(19)18(17(20)24-5-2)10-14(11-18)12-25-26(21,22)15-8-6-13(3)7-9-15/h6-9,14H,4-5,10-12H2,1-3H3 |
| InChIKey | CGZSMSIOSRBJFF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|