C22H29BrO8S — CID 11756870
trans-diethyl (3R,4S)-3-(1-bromo-2-methoxy-2-oxoethyl)-4-[(4-methylphenyl)sulfonylmethyl]cyclopentane-1,1-dicarboxylate (PubChem CID 11756870) has the molecular formula C22H29BrO8S and a molecular weight of 533.44 g/mol. Its IUPAC name is trans-diethyl (3R,4S)-3-(1-bromo-2-methoxy-2-oxoethyl)-4-[(4-methylphenyl)sulfonylmethyl]cyclopentane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (3R,4S)-3-(1-bromo-2-methoxy-2-oxoethyl)-4-[(4-methylphenyl)sulfonylmethyl]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11756870 |
| Molecular Formula | C22H29BrO8S |
| Molecular Weight | 533.44 g/mol |
| Exact Mass | 532.08 |
| IUPAC Name | trans-diethyl (3R,4S)-3-(1-bromo-2-methoxy-2-oxoethyl)-4-[(4-methylphenyl)sulfonylmethyl]cyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@H](CS(=O)(=O)c2ccc(C)cc2)[C@H](C(Br)C(=O)OC)C1 |
| InChI | InChI=1S/C22H29BrO8S/c1-5-30-20(25)22(21(26)31-6-2)11-15(17(12-22)18(23)19(24)29-4)13-32(27,28)16-9-7-14(3)8-10-16/h7-10,15,17-18H,5-6,11-13H2,1-4H3/t15-,17-,18?/m1/s1 |
| InChIKey | XVWHVGGZMITGDF-KOFGWKMWSA-N |
| XLogP | 2.84 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|