C20H22O6S2 — CID 11122697
dimethyl 7-[(4-methylphenyl)sulfonylmethyl]-6,7-dihydro-4H-1-benzothiophene-5,5-dicarboxylate (PubChem CID 11122697) has the molecular formula C20H22O6S2 and a molecular weight of 422.52 g/mol. Its IUPAC name is dimethyl 7-[(4-methylphenyl)sulfonylmethyl]-6,7-dihydro-4H-1-benzothiophene-5,5-dicarboxylate.
| Compound Name | dimethyl 7-[(4-methylphenyl)sulfonylmethyl]-6,7-dihydro-4H-1-benzothiophene-5,5-dicarboxylate |
|---|---|
| PubChem CID | 11122697 |
| Molecular Formula | C20H22O6S2 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | dimethyl 7-[(4-methylphenyl)sulfonylmethyl]-6,7-dihydro-4H-1-benzothiophene-5,5-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2ccsc2C(CS(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C20H22O6S2/c1-13-4-6-16(7-5-13)28(23,24)12-15-11-20(18(21)25-2,19(22)26-3)10-14-8-9-27-17(14)15/h4-9,15H,10-12H2,1-3H3 |
| InChIKey | BYKRIROZTJHNOF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|