C27H34O7S — CID 15423562
dipropan-2-yl 6-methoxy-4-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate (PubChem CID 15423562) has the molecular formula C27H34O7S and a molecular weight of 502.63 g/mol. Its IUPAC name is dipropan-2-yl 6-methoxy-4-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate.
| Compound Name | dipropan-2-yl 6-methoxy-4-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 15423562 |
| Molecular Formula | C27H34O7S |
| Molecular Weight | 502.63 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | dipropan-2-yl 6-methoxy-4-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate |
| SMILES | COc1ccc2c(c1)C(CS(=O)(=O)c1ccc(C)cc1)CC(C(=O)OC(C)C)(C(=O)OC(C)C)C2 |
| InChI | InChI=1S/C27H34O7S/c1-17(2)33-25(28)27(26(29)34-18(3)4)14-20-9-10-22(32-6)13-24(20)21(15-27)16-35(30,31)23-11-7-19(5)8-12-23/h7-13,17-18,21H,14-16H2,1-6H3 |
| InChIKey | XQYRIGNANNKAIV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|