C20H29NO6S — CID 86811230
dipropan-2-yl 1-(4-methylphenyl)sulfonylpiperidine-4,4-dicarboxylate (PubChem CID 86811230) has the molecular formula C20H29NO6S and a molecular weight of 411.52 g/mol. Its IUPAC name is dipropan-2-yl 1-(4-methylphenyl)sulfonylpiperidine-4,4-dicarboxylate.
| Compound Name | dipropan-2-yl 1-(4-methylphenyl)sulfonylpiperidine-4,4-dicarboxylate |
|---|---|
| PubChem CID | 86811230 |
| Molecular Formula | C20H29NO6S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | dipropan-2-yl 1-(4-methylphenyl)sulfonylpiperidine-4,4-dicarboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)OC(C)C)(C(=O)OC(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H29NO6S/c1-14(2)26-18(22)20(19(23)27-15(3)4)10-12-21(13-11-20)28(24,25)17-8-6-16(5)7-9-17/h6-9,14-15H,10-13H2,1-5H3 |
| InChIKey | TYMCHHVBICMWCW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|