C19H27NO6S — CID 171355643
3-(4-methylphenyl)sulfonyl-7,8,16,17-tetraoxa-3-azadispiro[5.2.69.26]heptadecane (PubChem CID 171355643) has the molecular formula C19H27NO6S and a molecular weight of 397.49 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfonyl-7,8,16,17-tetraoxa-3-azadispiro[5.2.69.26]heptadecane.
| Compound Name | 3-(4-methylphenyl)sulfonyl-7,8,16,17-tetraoxa-3-azadispiro[5.2.69.26]heptadecane |
|---|---|
| PubChem CID | 171355643 |
| Molecular Formula | C19H27NO6S |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 3-(4-methylphenyl)sulfonyl-7,8,16,17-tetraoxa-3-azadispiro[5.2.69.26]heptadecane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC3(CC2)OOC2(CCCCCC2)OO3)cc1 |
| InChI | InChI=1S/C19H27NO6S/c1-16-6-8-17(9-7-16)27(21,22)20-14-12-19(13-15-20)25-23-18(24-26-19)10-4-2-3-5-11-18/h6-9H,2-5,10-15H2,1H3 |
| InChIKey | WBMKVHZXHMBLIP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|