C27H45NO2S — CID 11396698
(11E)-1-(4-methylphenyl)sulfonyl-1-azacyclohenicos-11-ene (PubChem CID 11396698) has the molecular formula C27H45NO2S and a molecular weight of 447.73 g/mol. Its IUPAC name is (11E)-1-(4-methylphenyl)sulfonyl-1-azacyclohenicos-11-ene.
| Compound Name | (11E)-1-(4-methylphenyl)sulfonyl-1-azacyclohenicos-11-ene |
|---|---|
| PubChem CID | 11396698 |
| Molecular Formula | C27H45NO2S |
| Molecular Weight | 447.73 g/mol |
| Exact Mass | 447.32 |
| IUPAC Name | (11E)-1-(4-methylphenyl)sulfonyl-1-azacyclohenicos-11-ene |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCCCCCC/C=C/CCCCCCCCC2)cc1 |
| InChI | InChI=1S/C27H45NO2S/c1-26-20-22-27(23-21-26)31(29,30)28-24-18-16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-17-19-25-28/h2-3,20-23H,4-19,24-25H2,1H3/b3-2+ |
| InChIKey | ZVMPGLAMWMDVFL-NSCUHMNNSA-N |
| XLogP | 7.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.73 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|