C15H21NO2S — CID 102048950
(5Z,7S)-7-methyl-1-(4-methylphenyl)sulfonyl-3,4,7,8-tetrahydro-2H-azocine (PubChem CID 102048950) has the molecular formula C15H21NO2S and a molecular weight of 279.41 g/mol. Its IUPAC name is (5Z,7S)-7-methyl-1-(4-methylphenyl)sulfonyl-3,4,7,8-tetrahydro-2H-azocine.
| Compound Name | (5Z,7S)-7-methyl-1-(4-methylphenyl)sulfonyl-3,4,7,8-tetrahydro-2H-azocine |
|---|---|
| PubChem CID | 102048950 |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (5Z,7S)-7-methyl-1-(4-methylphenyl)sulfonyl-3,4,7,8-tetrahydro-2H-azocine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC/C=C\[C@H](C)C2)cc1 |
| InChI | InChI=1S/C15H21NO2S/c1-13-7-9-15(10-8-13)19(17,18)16-11-5-3-4-6-14(2)12-16/h4,6-10,14H,3,5,11-12H2,1-2H3/b6-4-/t14-/m0/s1 |
| InChIKey | YNWVZOWJNDSPCV-SDQPKGBYSA-N |
| XLogP | 2.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|