C30H32O6SSe — CID 101221914
dimethyl 3-[(4-methylphenyl)sulfonylmethyl]-4-[phenyl(phenylselanyl)methyl]cyclopentane-1,1-dicarboxylate (PubChem CID 101221914) has the molecular formula C30H32O6SSe and a molecular weight of 599.61 g/mol. Its IUPAC name is dimethyl 3-[(4-methylphenyl)sulfonylmethyl]-4-[phenyl(phenylselanyl)methyl]cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl 3-[(4-methylphenyl)sulfonylmethyl]-4-[phenyl(phenylselanyl)methyl]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101221914 |
| Molecular Formula | C30H32O6SSe |
| Molecular Weight | 599.61 g/mol |
| Exact Mass | 600.11 |
| IUPAC Name | dimethyl 3-[(4-methylphenyl)sulfonylmethyl]-4-[phenyl(phenylselanyl)methyl]cyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(CS(=O)(=O)c2ccc(C)cc2)C(C([Se]c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C30H32O6SSe/c1-21-14-16-24(17-15-21)37(33,34)20-23-18-30(28(31)35-2,29(32)36-3)19-26(23)27(22-10-6-4-7-11-22)38-25-12-8-5-9-13-25/h4-17,23,26-27H,18-20H2,1-3H3 |
| InChIKey | FNRCDOSVMYUTES-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.61 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|