C27H32O4SSe — CID 10346934
8,8-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]-3-(phenylselanylmethyl)spiro[4.5]decane-6,10-dione (PubChem CID 10346934) has the molecular formula C27H32O4SSe and a molecular weight of 531.58 g/mol. Its IUPAC name is 8,8-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]-3-(phenylselanylmethyl)spiro[4.5]decane-6,10-dione.
| Compound Name | 8,8-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]-3-(phenylselanylmethyl)spiro[4.5]decane-6,10-dione |
|---|---|
| PubChem CID | 10346934 |
| Molecular Formula | C27H32O4SSe |
| Molecular Weight | 531.58 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | 8,8-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]-3-(phenylselanylmethyl)spiro[4.5]decane-6,10-dione |
| SMILES | Cc1ccc(S(=O)(=O)CC2CC3(CC2C[Se]c2ccccc2)C(=O)CC(C)(C)CC3=O)cc1 |
| InChI | InChI=1S/C27H32O4SSe/c1-19-9-11-22(12-10-19)32(30,31)17-20-13-27(24(28)15-26(2,3)16-25(27)29)14-21(20)18-33-23-7-5-4-6-8-23/h4-12,20-21H,13-18H2,1-3H3 |
| InChIKey | SCDDGYKKSJNCFT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|