C17H26O4S — CID 10359033
(5R,6R)-2,2,4,4,6-pentamethyl-5-[(4-methylphenyl)sulfonylmethyl]-1,3-dioxane (PubChem CID 10359033) has the molecular formula C17H26O4S and a molecular weight of 326.46 g/mol. Its IUPAC name is (5R,6R)-2,2,4,4,6-pentamethyl-5-[(4-methylphenyl)sulfonylmethyl]-1,3-dioxane.
| Compound Name | (5R,6R)-2,2,4,4,6-pentamethyl-5-[(4-methylphenyl)sulfonylmethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 10359033 |
| Molecular Formula | C17H26O4S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (5R,6R)-2,2,4,4,6-pentamethyl-5-[(4-methylphenyl)sulfonylmethyl]-1,3-dioxane |
| SMILES | Cc1ccc(S(=O)(=O)C[C@@H]2[C@@H](C)OC(C)(C)OC2(C)C)cc1 |
| InChI | InChI=1S/C17H26O4S/c1-12-7-9-14(10-8-12)22(18,19)11-15-13(2)20-17(5,6)21-16(15,3)4/h7-10,13,15H,11H2,1-6H3/t13-,15-/m1/s1 |
| InChIKey | ZQBCFXUMPWKQAJ-UKRRQHHQSA-N |
| XLogP | 3.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |