C20H24O2SSe — CID 10341336
1-methyl-4-[[(1R,2S)-2-(phenylselanylmethyl)cyclopentyl]methylsulfonyl]benzene (PubChem CID 10341336) has the molecular formula C20H24O2SSe and a molecular weight of 407.44 g/mol. Its IUPAC name is 1-methyl-4-[[(1R,2S)-2-(phenylselanylmethyl)cyclopentyl]methylsulfonyl]benzene.
| Compound Name | 1-methyl-4-[[(1R,2S)-2-(phenylselanylmethyl)cyclopentyl]methylsulfonyl]benzene |
|---|---|
| PubChem CID | 10341336 |
| Molecular Formula | C20H24O2SSe |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 1-methyl-4-[[(1R,2S)-2-(phenylselanylmethyl)cyclopentyl]methylsulfonyl]benzene |
| SMILES | Cc1ccc(S(=O)(=O)C[C@@H]2CCC[C@@H]2C[Se]c2ccccc2)cc1 |
| InChI | InChI=1S/C20H24O2SSe/c1-16-10-12-19(13-11-16)23(21,22)14-17-6-5-7-18(17)15-24-20-8-3-2-4-9-20/h2-4,8-13,17-18H,5-7,14-15H2,1H3/t17-,18+/m0/s1 |
| InChIKey | WHWQAZPOVBTHPD-ZWKOTPCHSA-N |
| XLogP | 3.63 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|