C18H20O3S2 — CID 159387605
cis-(1R,2S)-2-[(4-phenoxyphenyl)sulfonylmethyl]cyclopentane-1-thiol (PubChem CID 159387605) has the molecular formula C18H20O3S2 and a molecular weight of 348.49 g/mol. Its IUPAC name is cis-(1R,2S)-2-[(4-phenoxyphenyl)sulfonylmethyl]cyclopentane-1-thiol.
| Compound Name | cis-(1R,2S)-2-[(4-phenoxyphenyl)sulfonylmethyl]cyclopentane-1-thiol |
|---|---|
| PubChem CID | 159387605 |
| Molecular Formula | C18H20O3S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | cis-(1R,2S)-2-[(4-phenoxyphenyl)sulfonylmethyl]cyclopentane-1-thiol |
| SMILES | O=S(=O)(C[C@@H]1CCC[C@H]1S)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C18H20O3S2/c19-23(20,13-14-5-4-8-18(14)22)17-11-9-16(10-12-17)21-15-6-2-1-3-7-15/h1-3,6-7,9-12,14,18,22H,4-5,8,13H2/t14-,18+/m0/s1 |
| InChIKey | RYLGJXPRTHNBJU-KBXCAEBGSA-N |
| XLogP | 4.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|