C15H17NO3S2 — CID 54495806
2-amino-3-(4-phenoxyphenyl)sulfonylpropane-1-thiol (PubChem CID 54495806) has the molecular formula C15H17NO3S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-amino-3-(4-phenoxyphenyl)sulfonylpropane-1-thiol.
| Compound Name | 2-amino-3-(4-phenoxyphenyl)sulfonylpropane-1-thiol |
|---|---|
| PubChem CID | 54495806 |
| Molecular Formula | C15H17NO3S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-amino-3-(4-phenoxyphenyl)sulfonylpropane-1-thiol |
| SMILES | NC(CS)CS(=O)(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C15H17NO3S2/c16-12(10-20)11-21(17,18)15-8-6-14(7-9-15)19-13-4-2-1-3-5-13/h1-9,12,20H,10-11,16H2 |
| InChIKey | XYZUIRWPVHOACI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|