C16H18O3S2 — CID 54239050
4-(4-phenoxyphenyl)sulfonylbutane-2-thiol (PubChem CID 54239050) has the molecular formula C16H18O3S2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 4-(4-phenoxyphenyl)sulfonylbutane-2-thiol.
| Compound Name | 4-(4-phenoxyphenyl)sulfonylbutane-2-thiol |
|---|---|
| PubChem CID | 54239050 |
| Molecular Formula | C16H18O3S2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 4-(4-phenoxyphenyl)sulfonylbutane-2-thiol |
| SMILES | CC(S)CCS(=O)(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C16H18O3S2/c1-13(20)11-12-21(17,18)16-9-7-15(8-10-16)19-14-5-3-2-4-6-14/h2-10,13,20H,11-12H2,1H3 |
| InChIKey | QORRKEUNQMAOKA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|