C16H14O9S2 — CID 656313
2-[4-[4-(carboxymethylsulfonyl)phenoxy]phenyl]sulfonylacetic acid (PubChem CID 656313) has the molecular formula C16H14O9S2 and a molecular weight of 414.41 g/mol. Its IUPAC name is 2-[4-[4-(carboxymethylsulfonyl)phenoxy]phenyl]sulfonylacetic acid.
| Compound Name | 2-[4-[4-(carboxymethylsulfonyl)phenoxy]phenyl]sulfonylacetic acid |
|---|---|
| PubChem CID | 656313 |
| Molecular Formula | C16H14O9S2 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | 2-[4-[4-(carboxymethylsulfonyl)phenoxy]phenyl]sulfonylacetic acid |
| SMILES | O=C(O)CS(=O)(=O)c1ccc(Oc2ccc(S(=O)(=O)CC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C16H14O9S2/c17-15(18)9-26(21,22)13-5-1-11(2-6-13)25-12-3-7-14(8-4-12)27(23,24)10-16(19)20/h1-8H,9-10H2,(H,17,18)(H,19,20) |
| InChIKey | GDAWKJNVWZWATE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |