C11H12O5S — CID 18459278
2-[(4-methoxyphenyl)sulfonylmethyl]prop-2-enoic acid (PubChem CID 18459278) has the molecular formula C11H12O5S and a molecular weight of 256.28 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)sulfonylmethyl]prop-2-enoic acid.
| Compound Name | 2-[(4-methoxyphenyl)sulfonylmethyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 18459278 |
| Molecular Formula | C11H12O5S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 2-[(4-methoxyphenyl)sulfonylmethyl]prop-2-enoic acid |
| SMILES | C=C(CS(=O)(=O)c1ccc(OC)cc1)C(=O)O |
| InChI | InChI=1S/C11H12O5S/c1-8(11(12)13)7-17(14,15)10-5-3-9(16-2)4-6-10/h3-6H,1,7H2,2H3,(H,12,13) |
| InChIKey | PGRNHIDALQBIKT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|