C17H27NO4S — CID 86992855
2-(4-methoxyphenyl)sulfonyl-N,N-bis(2-methylpropyl)acetamide (PubChem CID 86992855) has the molecular formula C17H27NO4S and a molecular weight of 341.47 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)sulfonyl-N,N-bis(2-methylpropyl)acetamide.
| Compound Name | 2-(4-methoxyphenyl)sulfonyl-N,N-bis(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 86992855 |
| Molecular Formula | C17H27NO4S |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 2-(4-methoxyphenyl)sulfonyl-N,N-bis(2-methylpropyl)acetamide |
| SMILES | COc1ccc(S(=O)(=O)CC(=O)N(CC(C)C)CC(C)C)cc1 |
| InChI | InChI=1S/C17H27NO4S/c1-13(2)10-18(11-14(3)4)17(19)12-23(20,21)16-8-6-15(22-5)7-9-16/h6-9,13-14H,10-12H2,1-5H3 |
| InChIKey | MZOASQVVWQAYFL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |